C27H24ClN3O2 — CID 40814784
(3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-phenylpiperidine-3-carboxamide (PubChem CID 40814784) has the molecular formula C27H24ClN3O2 and a molecular weight of 457.96 g/mol. Its IUPAC name is (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-phenylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 40814784 |
| Molecular Formula | C27H24ClN3O2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CCCN(c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)C1 |
| InChI | InChI=1S/C27H24ClN3O2/c28-20-13-14-23-22(16-20)24(18-8-3-1-4-9-18)25(27(33)30-23)31-15-7-10-19(17-31)26(32)29-21-11-5-2-6-12-21/h1-6,8-9,11-14,16,19H,7,10,15,17H2,(H,29,32)(H,30,33)/t19-/m1/s1 |
| InChIKey | LOCAEGARXDLUHN-LJQANCHMSA-N |
| XLogP | 5.70 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |