C31H26ClN3O2 — CID 4873996
1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide (PubChem CID 4873996) has the molecular formula C31H26ClN3O2 and a molecular weight of 508.02 g/mol. Its IUPAC name is 1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 4873996 |
| Molecular Formula | C31H26ClN3O2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1CCCN(c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)C1 |
| InChI | InChI=1S/C31H26ClN3O2/c32-23-15-16-27-25(18-23)28(21-9-2-1-3-10-21)29(31(37)34-27)35-17-7-12-22(19-35)30(36)33-26-14-6-11-20-8-4-5-13-24(20)26/h1-6,8-11,13-16,18,22H,7,12,17,19H2,(H,33,36)(H,34,37) |
| InChIKey | GUIROPLOBAIANA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |