C28H35ClN4O2 — CID 40816876
(3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide (PubChem CID 40816876) has the molecular formula C28H35ClN4O2 and a molecular weight of 495.07 g/mol. Its IUPAC name is (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40816876 |
| Molecular Formula | C28H35ClN4O2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (3R)-1-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)[C@@H]1CCCN(c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)C1 |
| InChI | InChI=1S/C28H35ClN4O2/c1-3-32(4-2)16-9-15-30-27(34)21-12-8-17-33(19-21)26-25(20-10-6-5-7-11-20)23-18-22(29)13-14-24(23)31-28(26)35/h5-7,10-11,13-14,18,21H,3-4,8-9,12,15-17,19H2,1-2H3,(H,30,34)(H,31,35)/t21-/m1/s1 |
| InChIKey | UCIOAOWXEZXYLF-OAQYLSRUSA-N |
| XLogP | 4.91 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|