7-methyl-1,8-naphthyridine-2-carboxylic acid

C10H8N2O2 — CID 40815981

IUPAC7-methyl-1,8-naphthyridine-2-carboxylic acid
SMILESCc1ccc2ccc(C(=O)O)nc2n1
InChIInChI=1S/C10H8N2O2/c1-6-2-3-7-4-5-8(10(13)14)12-9(7)11-6/h2-5H,1H3,(H,13,14)
InChIKeySYRROODKCBUUFP-UHFFFAOYSA-N
MW188.19 g/mol
LogP1.64
Rot. Bonds1

About 7-methyl-1,8-naphthyridine-2-carboxylic acid

7-methyl-1,8-naphthyridine-2-carboxylic acid (PubChem CID 40815981) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 7-methyl-1,8-naphthyridine-2-carboxylic acid.

Molecular Properties

Compound Name7-methyl-1,8-naphthyridine-2-carboxylic acid
PubChem CID40815981
Molecular FormulaC10H8N2O2
Molecular Weight188.19 g/mol
Exact Mass188.06
IUPAC Name7-methyl-1,8-naphthyridine-2-carboxylic acid
SMILESCc1ccc2ccc(C(=O)O)nc2n1
InChIInChI=1S/C10H8N2O2/c1-6-2-3-7-4-5-8(10(13)14)12-9(7)11-6/h2-5H,1H3,(H,13,14)
InChIKeySYRROODKCBUUFP-UHFFFAOYSA-N
XLogP1.64
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.19
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7-methyl-1,8-naphthyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methyl-1,8-naphthyridine-2-carboxylic acid?
The IUPAC name of 7-methyl-1,8-naphthyridine-2-carboxylic acid (CID 40815981) is 7-methyl-1,8-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 7-methyl-1,8-naphthyridine-2-carboxylic acid?
The canonical SMILES for 7-methyl-1,8-naphthyridine-2-carboxylic acid is Cc1ccc2ccc(C(=O)O)nc2n1.
What is the InChIKey of 7-methyl-1,8-naphthyridine-2-carboxylic acid?
The InChIKey is SYRROODKCBUUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-6-2-3-7-4-5-8(10(13)14)12-9(7)11-6/h2-5H,1H3,(H,13,14).
What are the key properties of 7-methyl-1,8-naphthyridine-2-carboxylic acid?
7-methyl-1,8-naphthyridine-2-carboxylic acid has a molecular weight of 188.19 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,8-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 40815981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).