C25H31ClN2O5S — CID 4081907
N-(3-chloro-4-methoxyphenyl)-5-(dibutylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 4081907) has the molecular formula C25H31ClN2O5S and a molecular weight of 507.05 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-(dibutylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-(dibutylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4081907 |
| Molecular Formula | C25H31ClN2O5S |
| Molecular Weight | 507.05 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-(dibutylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc2oc(C(=O)Nc3ccc(OC)c(Cl)c3)c(C)c2c1 |
| InChI | InChI=1S/C25H31ClN2O5S/c1-5-7-13-28(14-8-6-2)34(30,31)19-10-12-22-20(16-19)17(3)24(33-22)25(29)27-18-9-11-23(32-4)21(26)15-18/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,27,29) |
| InChIKey | IYBVBUFRRCHEJP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.05 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |