C16H23NO3S2 — CID 40819551
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 40819551) has the molecular formula C16H23NO3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40819551 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cc2c(s1)CCCCCC2)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23NO3S2/c1-17(13-8-9-22(19,20)11-13)16(18)15-10-12-6-4-2-3-5-7-14(12)21-15/h10,13H,2-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | MHZXMDZXIJVTDJ-CYBMUJFWSA-N |
| XLogP | 2.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |