C16H21N3OS2 — CID 40819742
2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 40819742) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 40819742 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | Cc1cc(SCC(=O)N[C@H](C)c2cccs2)nc(C(C)C)n1 |
| InChI | InChI=1S/C16H21N3OS2/c1-10(2)16-17-11(3)8-15(19-16)22-9-14(20)18-12(4)13-6-5-7-21-13/h5-8,10,12H,9H2,1-4H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | MFLOLPDRLIIYQU-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |