C20H21N5O2S — CID 40819927
N-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]pyrazine-2-carboxamide (PubChem CID 40819927) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 40819927 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(=O)N[C@@H](C)CCc1ccc(-c2csc(NC(=O)c3cnccn3)n2)cc1 |
| InChI | InChI=1S/C20H21N5O2S/c1-13(23-14(2)26)3-4-15-5-7-16(8-6-15)18-12-28-20(24-18)25-19(27)17-11-21-9-10-22-17/h5-13H,3-4H2,1-2H3,(H,23,26)(H,24,25,27)/t13-/m0/s1 |
| InChIKey | PTSPIQLTCFLXJP-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |