C17H21N3O2S — CID 9174080
2-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9174080) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9174080 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[4-[4-[(3S)-3-acetamidobutyl]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)CCc1ccc(-c2csc(CC(N)=O)n2)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-11(19-12(2)21)3-4-13-5-7-14(8-6-13)15-10-23-17(20-15)9-16(18)22/h5-8,10-11H,3-4,9H2,1-2H3,(H2,18,22)(H,19,21)/t11-/m0/s1 |
| InChIKey | ZPDAIEBSBGQACR-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |