C25H23N3O3S — CID 40819989
2-[(4S)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 40819989) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[(4S)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[(4S)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 40819989 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[(4S)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@@H](CCc2ccccc2)C1=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C25H23N3O3S/c29-23(26-20-13-7-8-14-22(20)32-19-11-5-2-6-12-19)17-28-24(30)21(27-25(28)31)16-15-18-9-3-1-4-10-18/h1-14,21H,15-17H2,(H,26,29)(H,27,31)/t21-/m0/s1 |
| InChIKey | VTARQSOAGJUOPZ-NRFANRHFSA-N |
| XLogP | 4.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|