C21H21BrN4O3 — CID 40822119
1-[(4-bromophenyl)methyl]-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]pyrazole-3-carboxamide (PubChem CID 40822119) has the molecular formula C21H21BrN4O3 and a molecular weight of 457.33 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 40822119 |
| Molecular Formula | C21H21BrN4O3 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]pyrazole-3-carboxamide |
| SMILES | COc1ccc(/C(C)=N/NC(=O)c2ccn(Cc3ccc(Br)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H21BrN4O3/c1-14(18-9-8-17(28-2)12-20(18)29-3)23-24-21(27)19-10-11-26(25-19)13-15-4-6-16(22)7-5-15/h4-12H,13H2,1-3H3,(H,24,27)/b23-14+ |
| InChIKey | NWHPQVDUIWCKSC-OEAKJJBVSA-N |
| XLogP | 3.87 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|