C20H23N3O3 — CID 40823466
(1R,6S)-6-[[4-(2-propan-2-ylimidazol-1-yl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 40823466) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (1R,6S)-6-[[4-(2-propan-2-ylimidazol-1-yl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[[4-(2-propan-2-ylimidazol-1-yl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40823466 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (1R,6S)-6-[[4-(2-propan-2-ylimidazol-1-yl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)c1nccn1-c1ccc(NC(=O)[C@H]2CC=CC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-13(2)18-21-11-12-23(18)15-9-7-14(8-10-15)22-19(24)16-5-3-4-6-17(16)20(25)26/h3-4,7-13,16-17H,5-6H2,1-2H3,(H,22,24)(H,25,26)/t16-,17+/m0/s1 |
| InChIKey | WIPBFCXUAFUVES-DLBZAZTESA-N |
| XLogP | 3.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|