C14H16Cl2N2O — CID 40823673
2-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]propan-2-ol (PubChem CID 40823673) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 2-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]propan-2-ol.
| Compound Name | 2-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 40823673 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc2ccccc2n1C[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c1-13(2,19)12-17-10-5-3-4-6-11(10)18(12)8-9-7-14(9,15)16/h3-6,9,19H,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | CHSADCVKNIDBPU-SECBINFHSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|