C25H22N2O6 — CID 40826733
ethyl (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]propanoate (PubChem CID 40826733) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is ethyl (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]propanoate.
| Compound Name | ethyl (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]propanoate |
|---|---|
| PubChem CID | 40826733 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | ethyl (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc2c(c1)c1ccnc3c4ccc(OC)c(OC)c4c(=O)n2c13 |
| InChI | InChI=1S/C25H22N2O6/c1-5-32-25(29)13(2)33-14-6-8-18-17(12-14)15-10-11-26-21-16-7-9-19(30-3)23(31-4)20(16)24(28)27(18)22(15)21/h6-13H,5H2,1-4H3/t13-/m1/s1 |
| InChIKey | ZOYNMYHTGNMNFN-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|