C16H18IN3OS — CID 4083168
N-(2-tert-butyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-iodobenzamide (PubChem CID 4083168) has the molecular formula C16H18IN3OS and a molecular weight of 427.31 g/mol. Its IUPAC name is N-(2-tert-butyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-iodobenzamide.
| Compound Name | N-(2-tert-butyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 4083168 |
| Molecular Formula | C16H18IN3OS |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-(2-tert-butyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-iodobenzamide |
| SMILES | CC(C)(C)n1nc2c(c1NC(=O)c1ccccc1I)CSC2 |
| InChI | InChI=1S/C16H18IN3OS/c1-16(2,3)20-14(11-8-22-9-13(11)19-20)18-15(21)10-6-4-5-7-12(10)17/h4-7H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | UXROSYFPRYHEDO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|