C16H18IN3O2S — CID 41060057
N-[(5R)-2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-2-iodobenzamide (PubChem CID 41060057) has the molecular formula C16H18IN3O2S and a molecular weight of 443.31 g/mol. Its IUPAC name is N-[(5R)-2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-2-iodobenzamide.
| Compound Name | N-[(5R)-2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 41060057 |
| Molecular Formula | C16H18IN3O2S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | N-[(5R)-2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-2-iodobenzamide |
| SMILES | CC(C)(C)n1nc2c(c1NC(=O)c1ccccc1I)C[S@@](=O)C2 |
| InChI | InChI=1S/C16H18IN3O2S/c1-16(2,3)20-14(11-8-23(22)9-13(11)19-20)18-15(21)10-6-4-5-7-12(10)17/h4-7H,8-9H2,1-3H3,(H,18,21)/t23-/m1/s1 |
| InChIKey | SVGVENDCCOWTEK-HSZRJFAPSA-N |
| XLogP | 3.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|