C24H22N2O7 — CID 40838030
6-[(5R,10bR)-2-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid (PubChem CID 40838030) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is 6-[(5R,10bR)-2-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(5R,10bR)-2-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 40838030 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 6-[(5R,10bR)-2-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1cccc2c1O[C@H](c1ccc(OC)c(OC)c1C(=O)O)N1N=C(c3ccco3)C[C@H]21 |
| InChI | InChI=1S/C24H22N2O7/c1-29-18-7-4-6-13-16-12-15(17-8-5-11-32-17)25-26(16)23(33-21(13)18)14-9-10-19(30-2)22(31-3)20(14)24(27)28/h4-11,16,23H,12H2,1-3H3,(H,27,28)/t16-,23-/m1/s1 |
| InChIKey | HUENYZYZHQRGAG-WAIKUNEKSA-N |
| XLogP | 4.25 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |