C23H27N3O4S — CID 40838896
(2S,4R)-2-[4-methoxy-3-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 40838896) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is (2S,4R)-2-[4-methoxy-3-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2S,4R)-2-[4-methoxy-3-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 40838896 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2S,4R)-2-[4-methoxy-3-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1ccc([C@H]2N[C@H](C(=O)O)CS2)cc1CN1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C23H27N3O4S/c1-30-20-6-5-15(22-24-18(13-31-22)23(28)29)8-17(20)12-25-9-14-7-16(11-25)19-3-2-4-21(27)26(19)10-14/h2-6,8,14,16,18,22,24H,7,9-13H2,1H3,(H,28,29)/t14-,16+,18-,22-/m0/s1 |
| InChIKey | MHTNSZSQTDOLMT-GIJXAMHUSA-N |
| XLogP | 2.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |