C19H21N3O5 — CID 98121638
(1S,9S)-11-[(2-hydroxy-3-methoxy-5-nitrophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 98121638) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (1S,9S)-11-[(2-hydroxy-3-methoxy-5-nitrophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[(2-hydroxy-3-methoxy-5-nitrophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 98121638 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (1S,9S)-11-[(2-hydroxy-3-methoxy-5-nitrophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cc([N+](=O)[O-])cc(CN2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)c1O |
| InChI | InChI=1S/C19H21N3O5/c1-27-17-7-15(22(25)26)6-14(19(17)24)11-20-8-12-5-13(10-20)16-3-2-4-18(23)21(16)9-12/h2-4,6-7,12-13,24H,5,8-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | RZTWLPIREHVXKQ-STQMWFEESA-N |
| XLogP | 2.09 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|