C21H18Cl2N2O2S — CID 40840186
(2R)-2-benzylsulfanyl-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]propanamide (PubChem CID 40840186) has the molecular formula C21H18Cl2N2O2S and a molecular weight of 433.36 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]propanamide.
| Compound Name | (2R)-2-benzylsulfanyl-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 40840186 |
| Molecular Formula | C21H18Cl2N2O2S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (2R)-2-benzylsulfanyl-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]propanamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H18Cl2N2O2S/c1-14(28-13-15-5-3-2-4-6-15)21(26)25-24-12-17-8-10-20(27-17)18-9-7-16(22)11-19(18)23/h2-12,14H,13H2,1H3,(H,25,26)/b24-12-/t14-/m1/s1 |
| InChIKey | PTJAZXIKQWDAHO-KPQXCZDLSA-N |
| XLogP | 6.03 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|