C28H24Cl2N2O2 — CID 40842004
(6R,9S)-5-acetyl-9-(3,4-dichlorophenyl)-6-(4-methylphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 40842004) has the molecular formula C28H24Cl2N2O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is (6R,9S)-5-acetyl-9-(3,4-dichlorophenyl)-6-(4-methylphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-5-acetyl-9-(3,4-dichlorophenyl)-6-(4-methylphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 40842004 |
| Molecular Formula | C28H24Cl2N2O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (6R,9S)-5-acetyl-9-(3,4-dichlorophenyl)-6-(4-methylphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(=O)N1c2ccccc2NC2=C(C(=O)C[C@@H](c3ccc(Cl)c(Cl)c3)C2)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O2/c1-16-7-9-18(10-8-16)28-27-24(31-23-5-3-4-6-25(23)32(28)17(2)33)14-20(15-26(27)34)19-11-12-21(29)22(30)13-19/h3-13,20,28,31H,14-15H2,1-2H3/t20-,28+/m0/s1 |
| InChIKey | XQQZSPAWMPYSCO-WTYVLRPYSA-N |
| XLogP | 7.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |