C31H32N2O5 — CID 1493104
(6R,9R)-5-acetyl-9-(4-methylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 1493104) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (6R,9R)-5-acetyl-9-(4-methylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-5-acetyl-9-(4-methylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1493104 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (6R,9R)-5-acetyl-9-(4-methylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc([C@@H]2C3=C(C[C@@H](c4ccc(C)cc4)CC3=O)Nc3ccccc3N2C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C31H32N2O5/c1-18-10-12-20(13-11-18)21-14-24-29(26(35)15-21)30(22-16-27(36-3)31(38-5)28(17-22)37-4)33(19(2)34)25-9-7-6-8-23(25)32-24/h6-13,16-17,21,30,32H,14-15H2,1-5H3/t21-,30-/m1/s1 |
| InChIKey | LSTFJVVRKYUJAB-IIMAJNMQSA-N |
| XLogP | 5.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |