C34H38N2O5 — CID 3509727
5-acetyl-9-(4-tert-butylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 3509727) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is 5-acetyl-9-(4-tert-butylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-acetyl-9-(4-tert-butylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3509727 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 5-acetyl-9-(4-tert-butylphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc(C2C3=C(CC(c4ccc(C(C)(C)C)cc4)CC3=O)Nc3ccccc3N2C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C34H38N2O5/c1-20(37)36-27-11-9-8-10-25(27)35-26-16-22(21-12-14-24(15-13-21)34(2,3)4)17-28(38)31(26)32(36)23-18-29(39-5)33(41-7)30(19-23)40-6/h8-15,18-19,22,32,35H,16-17H2,1-7H3 |
| InChIKey | ZMMCEEQHVPVEIL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |