C37H36N2O6 — CID 98215107
(6S,9S)-9-(4-methoxyphenyl)-5-(2-phenylacetyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 98215107) has the molecular formula C37H36N2O6 and a molecular weight of 604.70 g/mol. Its IUPAC name is (6S,9S)-9-(4-methoxyphenyl)-5-(2-phenylacetyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-9-(4-methoxyphenyl)-5-(2-phenylacetyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 98215107 |
| Molecular Formula | C37H36N2O6 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | (6S,9S)-9-(4-methoxyphenyl)-5-(2-phenylacetyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N(C(=O)Cc2ccccc2)[C@H]3c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C37H36N2O6/c1-42-27-16-14-24(15-17-27)25-19-29-35(31(40)20-25)36(26-21-32(43-2)37(45-4)33(22-26)44-3)39(30-13-9-8-12-28(30)38-29)34(41)18-23-10-6-5-7-11-23/h5-17,21-22,25,36,38H,18-20H2,1-4H3/t25-,36-/m0/s1 |
| InChIKey | FGNDYZKPCWKGSY-CZTRJMPPSA-N |
| XLogP | 6.86 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |