C36H33ClN2O6 — CID 98217869
(6R,9R)-5-(4-chlorobenzoyl)-9-(4-methoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 98217869) has the molecular formula C36H33ClN2O6 and a molecular weight of 625.12 g/mol. Its IUPAC name is (6R,9R)-5-(4-chlorobenzoyl)-9-(4-methoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-5-(4-chlorobenzoyl)-9-(4-methoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 98217869 |
| Molecular Formula | C36H33ClN2O6 |
| Molecular Weight | 625.12 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | (6R,9R)-5-(4-chlorobenzoyl)-9-(4-methoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)Nc2ccccc2N(C(=O)c2ccc(Cl)cc2)[C@@H]3c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C36H33ClN2O6/c1-42-26-15-11-21(12-16-26)23-17-28-33(30(40)18-23)34(24-19-31(43-2)35(45-4)32(20-24)44-3)39(29-8-6-5-7-27(29)38-28)36(41)22-9-13-25(37)14-10-22/h5-16,19-20,23,34,38H,17-18H2,1-4H3/t23-,34-/m1/s1 |
| InChIKey | CXRGNZRJGVFBFL-GRMGDBHTSA-N |
| XLogP | 7.59 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.12 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |