C18H21N3O4S — CID 40847894
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide (PubChem CID 40847894) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 40847894 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide |
| SMILES | CN(C)[C@@H](CNC(=O)C(=O)NCc1ccc2c(c1)OCO2)c1ccsc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-21(2)14(13-5-6-26-10-13)9-20-18(23)17(22)19-8-12-3-4-15-16(7-12)25-11-24-15/h3-7,10,14H,8-9,11H2,1-2H3,(H,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | NFGXPFHIFLUMFS-AWEZNQCLSA-N |
| XLogP | 1.51 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|