C14H18N2O5 — CID 7242407
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-1-hydroxybutan-2-yl]oxamide (PubChem CID 7242407) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-1-hydroxybutan-2-yl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-1-hydroxybutan-2-yl]oxamide |
|---|---|
| PubChem CID | 7242407 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2R)-1-hydroxybutan-2-yl]oxamide |
| SMILES | CC[C@H](CO)NC(=O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O5/c1-2-10(7-17)16-14(19)13(18)15-6-9-3-4-11-12(5-9)21-8-20-11/h3-5,10,17H,2,6-8H2,1H3,(H,15,18)(H,16,19)/t10-/m1/s1 |
| InChIKey | STQPALIJRKLVGC-SNVBAGLBSA-N |
| XLogP | -0.08 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|