C23H23NO5 — CID 40849874
(1R)-2-(3-ethoxypropyl)-1-(3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 40849874) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (1R)-2-(3-ethoxypropyl)-1-(3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-2-(3-ethoxypropyl)-1-(3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 40849874 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (1R)-2-(3-ethoxypropyl)-1-(3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOCCCN1C(=O)c2oc3ccccc3c(=O)c2[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C23H23NO5/c1-3-28-13-7-12-24-20(15-8-6-9-16(14-15)27-2)19-21(25)17-10-4-5-11-18(17)29-22(19)23(24)26/h4-6,8-11,14,20H,3,7,12-13H2,1-2H3/t20-/m1/s1 |
| InChIKey | MCPYFAMHVCLKFO-HXUWFJFHSA-N |
| XLogP | 3.77 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|