C22H26N2O3 — CID 4084988
N-[(3,4-dimethoxyphenyl)methyl]-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetamide (PubChem CID 4084988) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetamide |
|---|---|
| PubChem CID | 4084988 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetamide |
| SMILES | COc1ccc(CNC(=O)C=C2NC(C)(C)Cc3ccccc32)cc1OC |
| InChI | InChI=1S/C22H26N2O3/c1-22(2)13-16-7-5-6-8-17(16)18(24-22)12-21(25)23-14-15-9-10-19(26-3)20(11-15)27-4/h5-12,24H,13-14H2,1-4H3,(H,23,25) |
| InChIKey | WKIDVLGUJVDFJE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|