C23H21NO5S — CID 40852828
phenacyl (3S)-3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate (PubChem CID 40852828) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is phenacyl (3S)-3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | phenacyl (3S)-3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 40852828 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | phenacyl (3S)-3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
| SMILES | COc1ccc([C@H](CC(=O)OCC(=O)c2ccccc2)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H21NO5S/c1-28-18-11-9-16(10-12-18)19(24-23(27)21-8-5-13-30-21)14-22(26)29-15-20(25)17-6-3-2-4-7-17/h2-13,19H,14-15H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | SRUSUIFOYNKNAK-IBGZPJMESA-N |
| XLogP | 4.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |