C24H27N3O4S — CID 40853691
(3R,9bS)-N-[(1S)-2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxo-1-phenylethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 40853691) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is (3R,9bS)-N-[(1S)-2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxo-1-phenylethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[(1S)-2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxo-1-phenylethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 40853691 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3R,9bS)-N-[(1S)-2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxo-1-phenylethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | C[C@@H](CO)NC(=O)[C@@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@@H]2SC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-14(13-28)25-20(29)18(15-9-5-4-6-10-15)26-21(30)19-24(2,3)32-23-17-12-8-7-11-16(17)22(31)27(19)23/h4-12,14,18-19,23,28H,13H2,1-3H3,(H,25,29)(H,26,30)/t14-,18-,19+,23-/m0/s1 |
| InChIKey | RQKSAKPEGYTDID-JKXQAPCPSA-N |
| XLogP | 2.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |