C27H26N4O3S — CID 92506690
(3S,9bR)-2,2-dimethyl-5-oxo-N-[(1R)-2-oxo-1-phenyl-2-(pyridin-4-ylmethylamino)ethyl]-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 92506690) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is (3S,9bR)-2,2-dimethyl-5-oxo-N-[(1R)-2-oxo-1-phenyl-2-(pyridin-4-ylmethylamino)ethyl]-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3S,9bR)-2,2-dimethyl-5-oxo-N-[(1R)-2-oxo-1-phenyl-2-(pyridin-4-ylmethylamino)ethyl]-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 92506690 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (3S,9bR)-2,2-dimethyl-5-oxo-N-[(1R)-2-oxo-1-phenyl-2-(pyridin-4-ylmethylamino)ethyl]-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CC1(C)S[C@@H]2c3ccccc3C(=O)N2[C@H]1C(=O)N[C@@H](C(=O)NCc1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O3S/c1-27(2)22(31-25(34)19-10-6-7-11-20(19)26(31)35-27)24(33)30-21(18-8-4-3-5-9-18)23(32)29-16-17-12-14-28-15-13-17/h3-15,21-22,26H,16H2,1-2H3,(H,29,32)(H,30,33)/t21-,22+,26-/m1/s1 |
| InChIKey | SAJITZGSJOQWLQ-TVZXLZGTSA-N |
| XLogP | 3.60 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |