C24H21ClN2O2S — CID 4086767
4-benzyl-N-[2-(4-chlorophenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 4086767) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is 4-benzyl-N-[2-(4-chlorophenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-[2-(4-chlorophenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4086767 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-benzyl-N-[2-(4-chlorophenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2 |
| InChI | InChI=1S/C24H21ClN2O2S/c25-20-9-6-17(7-10-20)12-13-26-24(29)19-8-11-22-21(14-19)27(23(28)16-30-22)15-18-4-2-1-3-5-18/h1-11,14H,12-13,15-16H2,(H,26,29) |
| InChIKey | ARFLGFSYIXXGDL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |