C18H21NO3 — CID 40873086
(1R,6S)-6-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 40873086) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1R,6S)-6-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40873086 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1R,6S)-6-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(Nc1cccc2c1CCCC2)[C@H]1CC=CC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H21NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h3-5,7,11,14-15H,1-2,6,8-10H2,(H,19,20)(H,21,22)/t14-,15+/m0/s1 |
| InChIKey | CRKLKZMHRLSUDQ-LSDHHAIUSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|