C26H26N4O3S2 — CID 40873663
2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 40873663) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 40873663 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(-c2c(C)sc3ncn(CC(=O)Nc4sc5c(c4C(N)=O)CCCC5)c(=O)c23)cc1C |
| InChI | InChI=1S/C26H26N4O3S2/c1-13-8-9-16(10-14(13)2)20-15(3)34-24-22(20)26(33)30(12-28-24)11-19(31)29-25-21(23(27)32)17-6-4-5-7-18(17)35-25/h8-10,12H,4-7,11H2,1-3H3,(H2,27,32)(H,29,31) |
| InChIKey | LUOJZBUKPUITBZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |