C28H29N3O4S2 — CID 44636499
ethyl 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 44636499) has the molecular formula C28H29N3O4S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is ethyl 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 44636499 |
| Molecular Formula | C28H29N3O4S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 2-[[2-[5-(3,4-dimethylphenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cn2cnc3sc(C)c(-c4ccc(C)c(C)c4)c3c2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C28H29N3O4S2/c1-5-35-28(34)23-19-8-6-7-9-20(19)37-26(23)30-21(32)13-31-14-29-25-24(27(31)33)22(17(4)36-25)18-11-10-15(2)16(3)12-18/h10-12,14H,5-9,13H2,1-4H3,(H,30,32) |
| InChIKey | YGZZCFOGWCVZLZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |