C22H20N4O4S2 — CID 27400259
ethyl 2-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 27400259) has the molecular formula C22H20N4O4S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is ethyl 2-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 27400259 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 2-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)Cn3cnc4sc5c(c4c3=O)CCCC5)sc2c1 |
| InChI | InChI=1S/C22H20N4O4S2/c1-2-30-21(29)12-7-8-14-16(9-12)32-22(24-14)25-17(27)10-26-11-23-19-18(20(26)28)13-5-3-4-6-15(13)31-19/h7-9,11H,2-6,10H2,1H3,(H,24,25,27) |
| InChIKey | MHGOQGPLAZTDFR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |