C23H25N3O4S — CID 18275977
butyl 4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate (PubChem CID 18275977) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is butyl 4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18275977 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | butyl 4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2cnc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-2-3-12-30-23(29)15-8-10-16(11-9-15)25-19(27)13-26-14-24-21-20(22(26)28)17-6-4-5-7-18(17)31-21/h8-11,14H,2-7,12-13H2,1H3,(H,25,27) |
| InChIKey | SOUPVDMRDHRQID-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|