C26H24ClN3O4S — CID 40883479
butyl 4-[[2-[5-(4-chlorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate (PubChem CID 40883479) has the molecular formula C26H24ClN3O4S and a molecular weight of 510.02 g/mol. Its IUPAC name is butyl 4-[[2-[5-(4-chlorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[5-(4-chlorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 40883479 |
| Molecular Formula | C26H24ClN3O4S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | butyl 4-[[2-[5-(4-chlorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2cnc3sc(C)c(-c4ccc(Cl)cc4)c3c2=O)cc1 |
| InChI | InChI=1S/C26H24ClN3O4S/c1-3-4-13-34-26(33)18-7-11-20(12-8-18)29-21(31)14-30-15-28-24-23(25(30)32)22(16(2)35-24)17-5-9-19(27)10-6-17/h5-12,15H,3-4,13-14H2,1-2H3,(H,29,31) |
| InChIKey | OQGVRHJYYXHNCL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|