C25H22BrN3O4S — CID 44640327
butyl 4-[[2-[5-(4-bromophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate (PubChem CID 44640327) has the molecular formula C25H22BrN3O4S and a molecular weight of 540.44 g/mol. Its IUPAC name is butyl 4-[[2-[5-(4-bromophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[5-(4-bromophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 44640327 |
| Molecular Formula | C25H22BrN3O4S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | butyl 4-[[2-[5-(4-bromophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2cnc3scc(-c4ccc(Br)cc4)c3c2=O)cc1 |
| InChI | InChI=1S/C25H22BrN3O4S/c1-2-3-12-33-25(32)17-6-10-19(11-7-17)28-21(30)13-29-15-27-23-22(24(29)31)20(14-34-23)16-4-8-18(26)9-5-16/h4-11,14-15H,2-3,12-13H2,1H3,(H,28,30) |
| InChIKey | ZDYYTNDJBIMSLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|