C24H21N3O4S — CID 40883547
propyl 4-[[2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate (PubChem CID 40883547) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is propyl 4-[[2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 40883547 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | propyl 4-[[2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)Cn2cnc3scc(-c4ccccc4)c3c2=O)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-2-12-31-24(30)17-8-10-18(11-9-17)26-20(28)13-27-15-25-22-21(23(27)29)19(14-32-22)16-6-4-3-5-7-16/h3-11,14-15H,2,12-13H2,1H3,(H,26,28) |
| InChIKey | WQTSSKYDOMLFJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |