C18H22N4O5 — CID 40880178
2-[bis(furan-2-ylmethyl)amino]-N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40880178) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[bis(furan-2-ylmethyl)amino]-N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | 2-[bis(furan-2-ylmethyl)amino]-N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40880178 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[bis(furan-2-ylmethyl)amino]-N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@]1(C)NC(=O)N(NC(=O)CN(Cc2ccco2)Cc2ccco2)C1=O |
| InChI | InChI=1S/C18H22N4O5/c1-3-18(2)16(24)22(17(25)19-18)20-15(23)12-21(10-13-6-4-8-26-13)11-14-7-5-9-27-14/h4-9H,3,10-12H2,1-2H3,(H,19,25)(H,20,23)/t18-/m1/s1 |
| InChIKey | WYFGKTRBDJBBIR-GOSISDBHSA-N |
| XLogP | 1.63 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|