C18H26N4O4 — CID 18094902
N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide (PubChem CID 18094902) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide.
| Compound Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 18094902 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CN(C)CCOc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C18H26N4O4/c1-5-18(3)16(24)22(17(25)19-18)20-15(23)12-21(4)10-11-26-14-8-6-13(2)7-9-14/h6-9H,5,10-12H2,1-4H3,(H,19,25)(H,20,23) |
| InChIKey | PTDBJQIRCVUJRD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|