C24H21N3OS — CID 4088320
2-(1,4-diphenylimidazol-2-yl)sulfanyl-N-(4-methylphenyl)acetamide (PubChem CID 4088320) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-(1,4-diphenylimidazol-2-yl)sulfanyl-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(1,4-diphenylimidazol-2-yl)sulfanyl-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4088320 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-(1,4-diphenylimidazol-2-yl)sulfanyl-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc(-c3ccccc3)cn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3OS/c1-18-12-14-20(15-13-18)25-23(28)17-29-24-26-22(19-8-4-2-5-9-19)16-27(24)21-10-6-3-7-11-21/h2-16H,17H2,1H3,(H,25,28) |
| InChIKey | JDQZGRHPKVWPDS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |