C25H23N3OS — CID 4126512
N-(4-methylphenyl)-2-[1-(2-methylphenyl)-4-phenylimidazol-2-yl]sulfanylacetamide (PubChem CID 4126512) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[1-(2-methylphenyl)-4-phenylimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(4-methylphenyl)-2-[1-(2-methylphenyl)-4-phenylimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4126512 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-(4-methylphenyl)-2-[1-(2-methylphenyl)-4-phenylimidazol-2-yl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc(-c3ccccc3)cn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C25H23N3OS/c1-18-12-14-21(15-13-18)26-24(29)17-30-25-27-22(20-9-4-3-5-10-20)16-28(25)23-11-7-6-8-19(23)2/h3-16H,17H2,1-2H3,(H,26,29) |
| InChIKey | VDJPEWAWNRJMMU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |