C23H23N3O4S — CID 40884463
(3R,9bS)-N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 40884463) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is (3R,9bS)-N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 40884463 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (3R,9bS)-N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COc1ccc2c(c1OC)C(=O)N1[C@H](C(=O)NCCc3c[nH]c4ccccc34)CS[C@@H]21 |
| InChI | InChI=1S/C23H23N3O4S/c1-29-18-8-7-15-19(20(18)30-2)22(28)26-17(12-31-23(15)26)21(27)24-10-9-13-11-25-16-6-4-3-5-14(13)16/h3-8,11,17,23,25H,9-10,12H2,1-2H3,(H,24,27)/t17-,23-/m0/s1 |
| InChIKey | BRECCPFDBHMWAM-SBUREZEXSA-N |
| XLogP | 3.11 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |