C20H18Cl2N2O4S — CID 40884514
(3R,9bR)-N-[(2,4-dichlorophenyl)methyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 40884514) has the molecular formula C20H18Cl2N2O4S and a molecular weight of 453.35 g/mol. Its IUPAC name is (3R,9bR)-N-[(2,4-dichlorophenyl)methyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bR)-N-[(2,4-dichlorophenyl)methyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 40884514 |
| Molecular Formula | C20H18Cl2N2O4S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (3R,9bR)-N-[(2,4-dichlorophenyl)methyl]-6,7-dimethoxy-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COc1ccc2c(c1OC)C(=O)N1[C@@H]2SC[C@H]1C(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18Cl2N2O4S/c1-27-15-6-5-12-16(17(15)28-2)19(26)24-14(9-29-20(12)24)18(25)23-8-10-3-4-11(21)7-13(10)22/h3-7,14,20H,8-9H2,1-2H3,(H,23,25)/t14-,20+/m0/s1 |
| InChIKey | PEUQONCNQKBLCG-VBKZILBWSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |