C19H21N3O4S2 — CID 91823068
6,7-dimethoxy-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 91823068) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 6,7-dimethoxy-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | 6,7-dimethoxy-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 91823068 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 6,7-dimethoxy-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COc1ccc2c(c1OC)C(=O)N1C(C(=O)NCCc3nc(C)cs3)CSC21 |
| InChI | InChI=1S/C19H21N3O4S2/c1-10-8-27-14(21-10)6-7-20-17(23)12-9-28-19-11-4-5-13(25-2)16(26-3)15(11)18(24)22(12)19/h4-5,8,12,19H,6-7,9H2,1-3H3,(H,20,23) |
| InChIKey | OBEFYDLUJKUCCY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |