C22H22Cl2N2O4 — CID 40886784
2-(2,4-dichlorophenoxy)-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-8-yl)acetamide (PubChem CID 40886784) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-8-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-8-yl)acetamide |
|---|---|
| PubChem CID | 40886784 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-8-yl)acetamide |
| SMILES | C=CCN1C(=O)C(C)(C)COc2cc(NC(=O)COc3ccc(Cl)cc3Cl)ccc21 |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-4-9-26-17-7-6-15(11-19(17)30-13-22(2,3)21(26)28)25-20(27)12-29-18-8-5-14(23)10-16(18)24/h4-8,10-11H,1,9,12-13H2,2-3H3,(H,25,27) |
| InChIKey | UZCAWBNLACWXFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|