C22H23ClN2O4 — CID 40887452
5-chloro-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)-2-methoxybenzamide (PubChem CID 40887452) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 40887452 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-chloro-N-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)-2-methoxybenzamide |
| SMILES | C=CCN1C(=O)C(C)(C)COc2ccc(NC(=O)c3cc(Cl)ccc3OC)cc21 |
| InChI | InChI=1S/C22H23ClN2O4/c1-5-10-25-17-12-15(7-9-19(17)29-13-22(2,3)21(25)27)24-20(26)16-11-14(23)6-8-18(16)28-4/h5-9,11-12H,1,10,13H2,2-4H3,(H,24,26) |
| InChIKey | IVHVCPSASPFHRK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|